C15H22O8 — CID 10687844
[(1S,3R,7S,10R)-5,5,12,12-tetramethyl-9-oxo-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-1-yl]methyl acetate (PubChem CID 10687844) has the molecular formula C15H22O8 and a molecular weight of 330.33 g/mol. Its IUPAC name is [(1S,3R,7S,10R)-5,5,12,12-tetramethyl-9-oxo-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-1-yl]methyl acetate.
| Compound Name | [(1S,3R,7S,10R)-5,5,12,12-tetramethyl-9-oxo-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-1-yl]methyl acetate |
|---|---|
| PubChem CID | 10687844 |
| Molecular Formula | C15H22O8 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | [(1S,3R,7S,10R)-5,5,12,12-tetramethyl-9-oxo-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]12C[C@H]3OC(C)(C)O[C@H]3OC(=O)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C15H22O8/c1-8(16)18-7-15-6-9-12(22-13(2,3)20-9)19-11(17)10(15)21-14(4,5)23-15/h9-10,12H,6-7H2,1-5H3/t9-,10+,12-,15+/m1/s1 |
| InChIKey | ZVNQJOBEJBQYHV-HMDURAKOSA-N |
| XLogP | 0.86 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |