About CID 10687939
CID 10687939 (PubChem CID 10687939) has the molecular formula C17H19N2O5
and a molecular weight of 331.35 g/mol.
Molecular Properties
| Compound Name | CID 10687939 |
| PubChem CID | 10687939 |
| Molecular Formula | C17H19N2O5 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | — |
| SMILES | CC1(C)c2ccc(C(=O)ON3C(=O)CCC3=O)cc2C(C)(C)N1[O] |
| InChI | InChI=1S/C17H19N2O5/c1-16(2)11-6-5-10(9-12(11)17(3,4)19(16)23)15(22)24-18-13(20)7-8-14(18)21/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | SDPIFRKLYGVWQN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 86.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze CID 10687939 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10687939?
The IUPAC name of CID 10687939 (CID 10687939) is not available.
What is the SMILES notation for CID 10687939?
The canonical SMILES for CID 10687939 is CC1(C)c2ccc(C(=O)ON3C(=O)CCC3=O)cc2C(C)(C)N1[O].
What is the InChIKey of CID 10687939?
The InChIKey is SDPIFRKLYGVWQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N2O5/c1-16(2)11-6-5-10(9-12(11)17(3,4)19(16)23)15(22)24-18-13(20)7-8-14(18)21/h5-6,9H,7-8H2,1-4H3.
What are the key properties of CID 10687939?
CID 10687939 has a molecular weight of 331.35 g/mol, XLogP of 2.04, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10687939 is sourced from PubChem (CID 10687939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).