C21H32O3 — CID 10688041
4-[2-[(1S,5S,8aR)-5-(methoxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-2H-furan-5-one (PubChem CID 10688041) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is 4-[2-[(1S,5S,8aR)-5-(methoxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-2H-furan-5-one.
| Compound Name | 4-[2-[(1S,5S,8aR)-5-(methoxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 10688041 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 4-[2-[(1S,5S,8aR)-5-(methoxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-2H-furan-5-one |
| SMILES | C=C1CCC2[C@@](C)(COC)CCC[C@]2(C)[C@H]1CCC1=CCOC1=O |
| InChI | InChI=1S/C21H32O3/c1-15-6-9-18-20(2,14-23-4)11-5-12-21(18,3)17(15)8-7-16-10-13-24-19(16)22/h10,17-18H,1,5-9,11-14H2,2-4H3/t17-,18?,20+,21+/m0/s1 |
| InChIKey | RZMSHTBTEYFWPQ-MWBYQJBMSA-N |
| XLogP | 4.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|