About 2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-ethylethanamine
2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-ethylethanamine (PubChem CID 10688111) has the molecular formula C22H27N3
and a molecular weight of 333.48 g/mol. Its IUPAC name is 2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-ethylethanamine.
Molecular Properties
| Compound Name | 2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-ethylethanamine |
| PubChem CID | 10688111 |
| Molecular Formula | C22H27N3 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-ethylethanamine |
| SMILES | CCNCCc1cnc(CCC(c2ccccc2)c2ccccc2)[nH]1 |
| InChI | InChI=1S/C22H27N3/c1-2-23-16-15-20-17-24-22(25-20)14-13-21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,17,21,23H,2,13-16H2,1H3,(H,24,25) |
| InChIKey | HANVENUBICTJAH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-ethylethanamine?
The IUPAC name of 2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-ethylethanamine (CID 10688111) is 2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-ethylethanamine.
What is the SMILES notation for 2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-ethylethanamine?
The canonical SMILES for 2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-ethylethanamine is CCNCCc1cnc(CCC(c2ccccc2)c2ccccc2)[nH]1.
What is the InChIKey of 2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-ethylethanamine?
The InChIKey is HANVENUBICTJAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3/c1-2-23-16-15-20-17-24-22(25-20)14-13-21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,17,21,23H,2,13-16H2,1H3,(H,24,25).
What are the key properties of 2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-ethylethanamine?
2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-ethylethanamine has a molecular weight of 333.48 g/mol, XLogP of 4.33, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-ethylethanamine is sourced from PubChem (CID 10688111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).