About (2-fluoro-4,6-dimethylphenyl)-(1H-imidazol-2-yl)methanol
(2-fluoro-4,6-dimethylphenyl)-(1H-imidazol-2-yl)methanol (PubChem CID 106881131) has the molecular formula C12H13FN2O
and a molecular weight of 220.25 g/mol. Its IUPAC name is (2-fluoro-4,6-dimethylphenyl)-(1H-imidazol-2-yl)methanol.
Molecular Properties
| Compound Name | (2-fluoro-4,6-dimethylphenyl)-(1H-imidazol-2-yl)methanol |
| PubChem CID | 106881131 |
| Molecular Formula | C12H13FN2O |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | (2-fluoro-4,6-dimethylphenyl)-(1H-imidazol-2-yl)methanol |
| SMILES | Cc1cc(C)c(C(O)c2ncc[nH]2)c(F)c1 |
| InChI | InChI=1S/C12H13FN2O/c1-7-5-8(2)10(9(13)6-7)11(16)12-14-3-4-15-12/h3-6,11,16H,1-2H3,(H,14,15) |
| InChIKey | FOPRLQRTTBTCHJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-fluoro-4,6-dimethylphenyl)-(1H-imidazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluoro-4,6-dimethylphenyl)-(1H-imidazol-2-yl)methanol?
The IUPAC name of (2-fluoro-4,6-dimethylphenyl)-(1H-imidazol-2-yl)methanol (CID 106881131) is (2-fluoro-4,6-dimethylphenyl)-(1H-imidazol-2-yl)methanol.
What is the SMILES notation for (2-fluoro-4,6-dimethylphenyl)-(1H-imidazol-2-yl)methanol?
The canonical SMILES for (2-fluoro-4,6-dimethylphenyl)-(1H-imidazol-2-yl)methanol is Cc1cc(C)c(C(O)c2ncc[nH]2)c(F)c1.
What is the InChIKey of (2-fluoro-4,6-dimethylphenyl)-(1H-imidazol-2-yl)methanol?
The InChIKey is FOPRLQRTTBTCHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2O/c1-7-5-8(2)10(9(13)6-7)11(16)12-14-3-4-15-12/h3-6,11,16H,1-2H3,(H,14,15).
What are the key properties of (2-fluoro-4,6-dimethylphenyl)-(1H-imidazol-2-yl)methanol?
(2-fluoro-4,6-dimethylphenyl)-(1H-imidazol-2-yl)methanol has a molecular weight of 220.25 g/mol, XLogP of 2.25, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluoro-4,6-dimethylphenyl)-(1H-imidazol-2-yl)methanol is sourced from PubChem (CID 106881131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).