C16H23FO2 — CID 106881183
(2-fluoro-4,6-dimethylphenyl)-(1-methoxycyclohexyl)methanol (PubChem CID 106881183) has the molecular formula C16H23FO2 and a molecular weight of 266.36 g/mol. Its IUPAC name is (2-fluoro-4,6-dimethylphenyl)-(1-methoxycyclohexyl)methanol.
| Compound Name | (2-fluoro-4,6-dimethylphenyl)-(1-methoxycyclohexyl)methanol |
|---|---|
| PubChem CID | 106881183 |
| Molecular Formula | C16H23FO2 |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (2-fluoro-4,6-dimethylphenyl)-(1-methoxycyclohexyl)methanol |
| SMILES | COC1(C(O)c2c(C)cc(C)cc2F)CCCCC1 |
| InChI | InChI=1S/C16H23FO2/c1-11-9-12(2)14(13(17)10-11)15(18)16(19-3)7-5-4-6-8-16/h9-10,15,18H,4-8H2,1-3H3 |
| InChIKey | WTSGFCKARFFUCA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |