About 6-(2-fluoro-4,6-dimethylphenyl)-5-methyl-2-propylpyrimidin-4-amine
6-(2-fluoro-4,6-dimethylphenyl)-5-methyl-2-propylpyrimidin-4-amine (PubChem CID 106882792) has the molecular formula C16H20FN3
and a molecular weight of 273.35 g/mol. Its IUPAC name is 6-(2-fluoro-4,6-dimethylphenyl)-5-methyl-2-propylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-(2-fluoro-4,6-dimethylphenyl)-5-methyl-2-propylpyrimidin-4-amine |
| PubChem CID | 106882792 |
| Molecular Formula | C16H20FN3 |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 6-(2-fluoro-4,6-dimethylphenyl)-5-methyl-2-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(N)c(C)c(-c2c(C)cc(C)cc2F)n1 |
| InChI | InChI=1S/C16H20FN3/c1-5-6-13-19-15(11(4)16(18)20-13)14-10(3)7-9(2)8-12(14)17/h7-8H,5-6H2,1-4H3,(H2,18,19,20) |
| InChIKey | XPRWXMDCENFEOT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(2-fluoro-4,6-dimethylphenyl)-5-methyl-2-propylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-fluoro-4,6-dimethylphenyl)-5-methyl-2-propylpyrimidin-4-amine?
The IUPAC name of 6-(2-fluoro-4,6-dimethylphenyl)-5-methyl-2-propylpyrimidin-4-amine (CID 106882792) is 6-(2-fluoro-4,6-dimethylphenyl)-5-methyl-2-propylpyrimidin-4-amine.
What is the SMILES notation for 6-(2-fluoro-4,6-dimethylphenyl)-5-methyl-2-propylpyrimidin-4-amine?
The canonical SMILES for 6-(2-fluoro-4,6-dimethylphenyl)-5-methyl-2-propylpyrimidin-4-amine is CCCc1nc(N)c(C)c(-c2c(C)cc(C)cc2F)n1.
What is the InChIKey of 6-(2-fluoro-4,6-dimethylphenyl)-5-methyl-2-propylpyrimidin-4-amine?
The InChIKey is XPRWXMDCENFEOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20FN3/c1-5-6-13-19-15(11(4)16(18)20-13)14-10(3)7-9(2)8-12(14)17/h7-8H,5-6H2,1-4H3,(H2,18,19,20).
What are the key properties of 6-(2-fluoro-4,6-dimethylphenyl)-5-methyl-2-propylpyrimidin-4-amine?
6-(2-fluoro-4,6-dimethylphenyl)-5-methyl-2-propylpyrimidin-4-amine has a molecular weight of 273.35 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-fluoro-4,6-dimethylphenyl)-5-methyl-2-propylpyrimidin-4-amine is sourced from PubChem (CID 106882792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).