C14H18FNO — CID 106883000
1-(2-fluoro-4,6-dimethylphenyl)-2-pyrrolidin-2-ylethanone (PubChem CID 106883000) has the molecular formula C14H18FNO and a molecular weight of 235.30 g/mol. Its IUPAC name is 1-(2-fluoro-4,6-dimethylphenyl)-2-pyrrolidin-2-ylethanone.
| Compound Name | 1-(2-fluoro-4,6-dimethylphenyl)-2-pyrrolidin-2-ylethanone |
|---|---|
| PubChem CID | 106883000 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 1-(2-fluoro-4,6-dimethylphenyl)-2-pyrrolidin-2-ylethanone |
| SMILES | Cc1cc(C)c(C(=O)CC2CCCN2)c(F)c1 |
| InChI | InChI=1S/C14H18FNO/c1-9-6-10(2)14(12(15)7-9)13(17)8-11-4-3-5-16-11/h6-7,11,16H,3-5,8H2,1-2H3 |
| InChIKey | GWTNGZVHGKCCAU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |