C17H23NO6 — CID 10688318
[3-[[(5S,6R)-6-hydroxy-2,2-dimethyl-1,3-dioxepan-5-yl]carbamoyl]-2-methylphenyl] acetate (PubChem CID 10688318) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is [3-[[(5S,6R)-6-hydroxy-2,2-dimethyl-1,3-dioxepan-5-yl]carbamoyl]-2-methylphenyl] acetate.
| Compound Name | [3-[[(5S,6R)-6-hydroxy-2,2-dimethyl-1,3-dioxepan-5-yl]carbamoyl]-2-methylphenyl] acetate |
|---|---|
| PubChem CID | 10688318 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [3-[[(5S,6R)-6-hydroxy-2,2-dimethyl-1,3-dioxepan-5-yl]carbamoyl]-2-methylphenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)N[C@H]2COC(C)(C)OC[C@@H]2O)c1C |
| InChI | InChI=1S/C17H23NO6/c1-10-12(6-5-7-15(10)24-11(2)19)16(21)18-13-8-22-17(3,4)23-9-14(13)20/h5-7,13-14,20H,8-9H2,1-4H3,(H,18,21)/t13-,14-/m0/s1 |
| InChIKey | ZUAQAELXHOKBBD-KBPBESRZSA-N |
| XLogP | 1.16 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|