C15H13F4N — CID 106883591
(2-fluoro-4,6-dimethylphenyl)-(2,3,4-trifluorophenyl)methanamine (PubChem CID 106883591) has the molecular formula C15H13F4N and a molecular weight of 283.27 g/mol. Its IUPAC name is (2-fluoro-4,6-dimethylphenyl)-(2,3,4-trifluorophenyl)methanamine.
| Compound Name | (2-fluoro-4,6-dimethylphenyl)-(2,3,4-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 106883591 |
| Molecular Formula | C15H13F4N |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (2-fluoro-4,6-dimethylphenyl)-(2,3,4-trifluorophenyl)methanamine |
| SMILES | Cc1cc(C)c(C(N)c2ccc(F)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C15H13F4N/c1-7-5-8(2)12(11(17)6-7)15(20)9-3-4-10(16)14(19)13(9)18/h3-6,15H,20H2,1-2H3 |
| InChIKey | DOPUXVBPKVOYTI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|