C18H10N8 — CID 10688377
[2-[2-[3,6-bis(cyanoimino)cyclohexa-1,4-dien-1-yl]ethyl]-4-cyanoiminocyclohexa-2,5-dien-1-ylidene]cyanamide (PubChem CID 10688377) has the molecular formula C18H10N8 and a molecular weight of 338.33 g/mol. Its IUPAC name is [2-[2-[3,6-bis(cyanoimino)cyclohexa-1,4-dien-1-yl]ethyl]-4-cyanoiminocyclohexa-2,5-dien-1-ylidene]cyanamide.
| Compound Name | [2-[2-[3,6-bis(cyanoimino)cyclohexa-1,4-dien-1-yl]ethyl]-4-cyanoiminocyclohexa-2,5-dien-1-ylidene]cyanamide |
|---|---|
| PubChem CID | 10688377 |
| Molecular Formula | C18H10N8 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | [2-[2-[3,6-bis(cyanoimino)cyclohexa-1,4-dien-1-yl]ethyl]-4-cyanoiminocyclohexa-2,5-dien-1-ylidene]cyanamide |
| SMILES | N#C/N=C1\C=C/C(=N\C#N)C(CCC2=C/C(=N/C#N)C=C/C2=N\C#N)=C1 |
| InChI | InChI=1S/C18H10N8/c19-9-23-15-3-5-17(25-11-21)13(7-15)1-2-14-8-16(24-10-20)4-6-18(14)26-12-22/h3-8H,1-2H2/b23-15+,24-16+,25-17+,26-18+ |
| InChIKey | VHZFICMZCRHNSN-BDVUCFRDSA-N |
| XLogP | 2.45 |
| TPSA | 144.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|