About (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(1,1-dioxothian-2-yl)methanone
(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(1,1-dioxothian-2-yl)methanone (PubChem CID 106884916) has the molecular formula C13H13BrN2O3S
and a molecular weight of 357.23 g/mol. Its IUPAC name is (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(1,1-dioxothian-2-yl)methanone.
Molecular Properties
| Compound Name | (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(1,1-dioxothian-2-yl)methanone |
| PubChem CID | 106884916 |
| Molecular Formula | C13H13BrN2O3S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(1,1-dioxothian-2-yl)methanone |
| SMILES | O=C(c1c[nH]c2ncc(Br)cc12)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C13H13BrN2O3S/c14-8-5-9-10(7-16-13(9)15-6-8)12(17)11-3-1-2-4-20(11,18)19/h5-7,11H,1-4H2,(H,15,16) |
| InChIKey | DIHHYBULZSPCED-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(1,1-dioxothian-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(1,1-dioxothian-2-yl)methanone?
The IUPAC name of (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(1,1-dioxothian-2-yl)methanone (CID 106884916) is (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(1,1-dioxothian-2-yl)methanone.
What is the SMILES notation for (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(1,1-dioxothian-2-yl)methanone?
The canonical SMILES for (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(1,1-dioxothian-2-yl)methanone is O=C(c1c[nH]c2ncc(Br)cc12)C1CCCCS1(=O)=O.
What is the InChIKey of (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(1,1-dioxothian-2-yl)methanone?
The InChIKey is DIHHYBULZSPCED-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrN2O3S/c14-8-5-9-10(7-16-13(9)15-6-8)12(17)11-3-1-2-4-20(11,18)19/h5-7,11H,1-4H2,(H,15,16).
What are the key properties of (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(1,1-dioxothian-2-yl)methanone?
(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(1,1-dioxothian-2-yl)methanone has a molecular weight of 357.23 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(1,1-dioxothian-2-yl)methanone is sourced from PubChem (CID 106884916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).