About 2-chloro-1-(6-chloro-4-methylspiro[3,4-dihydroquinoline-2,1'-cycloheptane]-1-yl)ethanone
2-chloro-1-(6-chloro-4-methylspiro[3,4-dihydroquinoline-2,1'-cycloheptane]-1-yl)ethanone (PubChem CID 10688494) has the molecular formula C18H23Cl2NO
and a molecular weight of 340.29 g/mol. Its IUPAC name is 2-chloro-1-(6-chloro-4-methylspiro[3,4-dihydroquinoline-2,1'-cycloheptane]-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-chloro-1-(6-chloro-4-methylspiro[3,4-dihydroquinoline-2,1'-cycloheptane]-1-yl)ethanone |
| PubChem CID | 10688494 |
| Molecular Formula | C18H23Cl2NO |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-chloro-1-(6-chloro-4-methylspiro[3,4-dihydroquinoline-2,1'-cycloheptane]-1-yl)ethanone |
| SMILES | CC1CC2(CCCCCC2)N(C(=O)CCl)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H23Cl2NO/c1-13-11-18(8-4-2-3-5-9-18)21(17(22)12-19)16-7-6-14(20)10-15(13)16/h6-7,10,13H,2-5,8-9,11-12H2,1H3 |
| InChIKey | SBGCXWVGFHTNJH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-(6-chloro-4-methylspiro[3,4-dihydroquinoline-2,1'-cycloheptane]-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-(6-chloro-4-methylspiro[3,4-dihydroquinoline-2,1'-cycloheptane]-1-yl)ethanone?
The IUPAC name of 2-chloro-1-(6-chloro-4-methylspiro[3,4-dihydroquinoline-2,1'-cycloheptane]-1-yl)ethanone (CID 10688494) is 2-chloro-1-(6-chloro-4-methylspiro[3,4-dihydroquinoline-2,1'-cycloheptane]-1-yl)ethanone.
What is the SMILES notation for 2-chloro-1-(6-chloro-4-methylspiro[3,4-dihydroquinoline-2,1'-cycloheptane]-1-yl)ethanone?
The canonical SMILES for 2-chloro-1-(6-chloro-4-methylspiro[3,4-dihydroquinoline-2,1'-cycloheptane]-1-yl)ethanone is CC1CC2(CCCCCC2)N(C(=O)CCl)c2ccc(Cl)cc21.
What is the InChIKey of 2-chloro-1-(6-chloro-4-methylspiro[3,4-dihydroquinoline-2,1'-cycloheptane]-1-yl)ethanone?
The InChIKey is SBGCXWVGFHTNJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23Cl2NO/c1-13-11-18(8-4-2-3-5-9-18)21(17(22)12-19)16-7-6-14(20)10-15(13)16/h6-7,10,13H,2-5,8-9,11-12H2,1H3.
What are the key properties of 2-chloro-1-(6-chloro-4-methylspiro[3,4-dihydroquinoline-2,1'-cycloheptane]-1-yl)ethanone?
2-chloro-1-(6-chloro-4-methylspiro[3,4-dihydroquinoline-2,1'-cycloheptane]-1-yl)ethanone has a molecular weight of 340.29 g/mol, XLogP of 5.51, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-(6-chloro-4-methylspiro[3,4-dihydroquinoline-2,1'-cycloheptane]-1-yl)ethanone is sourced from PubChem (CID 10688494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).