C9H15BrN2O — CID 106885701
1-(3-bromofuran-2-yl)-N-propan-2-ylethane-1,2-diamine (PubChem CID 106885701) has the molecular formula C9H15BrN2O and a molecular weight of 247.14 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-N-propan-2-ylethane-1,2-diamine.
| Compound Name | 1-(3-bromofuran-2-yl)-N-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 106885701 |
| Molecular Formula | C9H15BrN2O |
| Molecular Weight | 247.14 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-N-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)NC(CN)c1occc1Br |
| InChI | InChI=1S/C9H15BrN2O/c1-6(2)12-8(5-11)9-7(10)3-4-13-9/h3-4,6,8,12H,5,11H2,1-2H3 |
| InChIKey | VXNGFWVILBGVRA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.14 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |