C16H22O3Se — CID 10688576
methyl (3S,4R,5S)-5-ethyl-2,2-dimethyl-4-phenylselanyloxolane-3-carboxylate (PubChem CID 10688576) has the molecular formula C16H22O3Se and a molecular weight of 341.31 g/mol. Its IUPAC name is methyl (3S,4R,5S)-5-ethyl-2,2-dimethyl-4-phenylselanyloxolane-3-carboxylate.
| Compound Name | methyl (3S,4R,5S)-5-ethyl-2,2-dimethyl-4-phenylselanyloxolane-3-carboxylate |
|---|---|
| PubChem CID | 10688576 |
| Molecular Formula | C16H22O3Se |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | methyl (3S,4R,5S)-5-ethyl-2,2-dimethyl-4-phenylselanyloxolane-3-carboxylate |
| SMILES | CC[C@@H]1OC(C)(C)[C@@H](C(=O)OC)[C@H]1[Se]c1ccccc1 |
| InChI | InChI=1S/C16H22O3Se/c1-5-12-14(20-11-9-7-6-8-10-11)13(15(17)18-4)16(2,3)19-12/h6-10,12-14H,5H2,1-4H3/t12-,13+,14-/m0/s1 |
| InChIKey | KANNMAOTQZWZAK-MJBXVCDLSA-N |
| XLogP | 2.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|