C21H18N4O — CID 10688672
3-(1-adamantyloxymethyl)benzene-1,2,4,5-tetracarbonitrile (PubChem CID 10688672) has the molecular formula C21H18N4O and a molecular weight of 342.40 g/mol. Its IUPAC name is 3-(1-adamantyloxymethyl)benzene-1,2,4,5-tetracarbonitrile.
| Compound Name | 3-(1-adamantyloxymethyl)benzene-1,2,4,5-tetracarbonitrile |
|---|---|
| PubChem CID | 10688672 |
| Molecular Formula | C21H18N4O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 3-(1-adamantyloxymethyl)benzene-1,2,4,5-tetracarbonitrile |
| SMILES | N#Cc1cc(C#N)c(C#N)c(COC23CC4CC(CC(C4)C2)C3)c1C#N |
| InChI | InChI=1S/C21H18N4O/c22-8-16-4-17(9-23)19(11-25)20(18(16)10-24)12-26-21-5-13-1-14(6-21)3-15(2-13)7-21/h4,13-15H,1-3,5-7,12H2 |
| InChIKey | YMLNNAXXAKYWPJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 104.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |