C15H19NO — CID 106887026
N-[[3-(2,5-dimethylphenyl)furan-2-yl]methyl]ethanamine (PubChem CID 106887026) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is N-[[3-(2,5-dimethylphenyl)furan-2-yl]methyl]ethanamine.
| Compound Name | N-[[3-(2,5-dimethylphenyl)furan-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 106887026 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | N-[[3-(2,5-dimethylphenyl)furan-2-yl]methyl]ethanamine |
| SMILES | CCNCc1occc1-c1cc(C)ccc1C |
| InChI | InChI=1S/C15H19NO/c1-4-16-10-15-13(7-8-17-15)14-9-11(2)5-6-12(14)3/h5-9,16H,4,10H2,1-3H3 |
| InChIKey | SWRDXMWQHVJANP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |