C15H15Cl2NO2S — CID 10688782
(1S,2R,7S,8R)-4-(aziridin-1-yl)-2,7-dichloro-5-ethylsulfanyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 10688782) has the molecular formula C15H15Cl2NO2S and a molecular weight of 344.26 g/mol. Its IUPAC name is (1S,2R,7S,8R)-4-(aziridin-1-yl)-2,7-dichloro-5-ethylsulfanyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | (1S,2R,7S,8R)-4-(aziridin-1-yl)-2,7-dichloro-5-ethylsulfanyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 10688782 |
| Molecular Formula | C15H15Cl2NO2S |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | (1S,2R,7S,8R)-4-(aziridin-1-yl)-2,7-dichloro-5-ethylsulfanyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | CCSC1=C(N2CC2)C(=O)[C@]2(Cl)[C@@H]3C=C[C@@H](C3)[C@]2(Cl)C1=O |
| InChI | InChI=1S/C15H15Cl2NO2S/c1-2-21-11-10(18-5-6-18)12(19)14(16)8-3-4-9(7-8)15(14,17)13(11)20/h3-4,8-9H,2,5-7H2,1H3/t8-,9+,14-,15+/m1/s1 |
| InChIKey | PDTUSQQUWNEGEN-PPZCWDAYSA-N |
| XLogP | 2.58 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|