C12H13F3N2OS — CID 106888389
N-[[3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]furan-2-yl]methyl]propan-1-amine (PubChem CID 106888389) has the molecular formula C12H13F3N2OS and a molecular weight of 290.31 g/mol. Its IUPAC name is N-[[3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]furan-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]furan-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 106888389 |
| Molecular Formula | C12H13F3N2OS |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | N-[[3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]furan-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1occc1-c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C12H13F3N2OS/c1-2-4-16-6-9-8(3-5-18-9)10-7-17-11(19-10)12(13,14)15/h3,5,7,16H,2,4,6H2,1H3 |
| InChIKey | HHCQOYXEPMDIPD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|