C17H32O5Si — CID 10688840
[(2S,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3,6-dihydro-2H-pyran-6-yl] 2,2-dimethylpropanoate (PubChem CID 10688840) has the molecular formula C17H32O5Si and a molecular weight of 344.52 g/mol. Its IUPAC name is [(2S,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3,6-dihydro-2H-pyran-6-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3,6-dihydro-2H-pyran-6-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10688840 |
| Molecular Formula | C17H32O5Si |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | [(2S,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3,6-dihydro-2H-pyran-6-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@H]1C=C[C@H](O)[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C17H32O5Si/c1-16(2,3)15(19)22-14-10-9-12(18)13(21-14)11-20-23(7,8)17(4,5)6/h9-10,12-14,18H,11H2,1-8H3/t12-,13-,14-/m0/s1 |
| InChIKey | HPMCJILMTVJJEO-IHRRRGAJSA-N |
| XLogP | 3.24 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|