C15H16O2 — CID 106888488
3-(3,4-diethylphenyl)furan-2-carbaldehyde (PubChem CID 106888488) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-(3,4-diethylphenyl)furan-2-carbaldehyde.
| Compound Name | 3-(3,4-diethylphenyl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 106888488 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 3-(3,4-diethylphenyl)furan-2-carbaldehyde |
| SMILES | CCc1ccc(-c2ccoc2C=O)cc1CC |
| InChI | InChI=1S/C15H16O2/c1-3-11-5-6-13(9-12(11)4-2)14-7-8-17-15(14)10-16/h5-10H,3-4H2,1-2H3 |
| InChIKey | UFKZLXOQVZEKNO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|