C11H4Cl4O2 — CID 106888507
3-(2,3,4,6-tetrachlorophenyl)furan-2-carbaldehyde (PubChem CID 106888507) has the molecular formula C11H4Cl4O2 and a molecular weight of 309.96 g/mol. Its IUPAC name is 3-(2,3,4,6-tetrachlorophenyl)furan-2-carbaldehyde.
| Compound Name | 3-(2,3,4,6-tetrachlorophenyl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 106888507 |
| Molecular Formula | C11H4Cl4O2 |
| Molecular Weight | 309.96 g/mol |
| Exact Mass | 307.90 |
| IUPAC Name | 3-(2,3,4,6-tetrachlorophenyl)furan-2-carbaldehyde |
| SMILES | O=Cc1occc1-c1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C11H4Cl4O2/c12-6-3-7(13)10(14)11(15)9(6)5-1-2-17-8(5)4-16/h1-4H |
| InChIKey | UTLDQNGTCVBIGG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.96 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|