C15H17F2NO2 — CID 106888520
N-[[5-(2,6-difluoro-4-methoxyphenyl)furan-2-yl]methyl]propan-1-amine (PubChem CID 106888520) has the molecular formula C15H17F2NO2 and a molecular weight of 281.30 g/mol. Its IUPAC name is N-[[5-(2,6-difluoro-4-methoxyphenyl)furan-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(2,6-difluoro-4-methoxyphenyl)furan-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 106888520 |
| Molecular Formula | C15H17F2NO2 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-[[5-(2,6-difluoro-4-methoxyphenyl)furan-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(-c2c(F)cc(OC)cc2F)o1 |
| InChI | InChI=1S/C15H17F2NO2/c1-3-6-18-9-10-4-5-14(20-10)15-12(16)7-11(19-2)8-13(15)17/h4-5,7-8,18H,3,6,9H2,1-2H3 |
| InChIKey | SYODVPDLVQKCTA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|