About [3-(2,3,5,6-tetrachlorophenyl)furan-2-yl]methanamine
[3-(2,3,5,6-tetrachlorophenyl)furan-2-yl]methanamine (PubChem CID 106888558) has the molecular formula C11H7Cl4NO
and a molecular weight of 311.00 g/mol. Its IUPAC name is [3-(2,3,5,6-tetrachlorophenyl)furan-2-yl]methanamine.
Molecular Properties
| Compound Name | [3-(2,3,5,6-tetrachlorophenyl)furan-2-yl]methanamine |
| PubChem CID | 106888558 |
| Molecular Formula | C11H7Cl4NO |
| Molecular Weight | 311.00 g/mol |
| Exact Mass | 308.93 |
| IUPAC Name | [3-(2,3,5,6-tetrachlorophenyl)furan-2-yl]methanamine |
| SMILES | NCc1occc1-c1c(Cl)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C11H7Cl4NO/c12-6-3-7(13)11(15)9(10(6)14)5-1-2-17-8(5)4-16/h1-3H,4,16H2 |
| InChIKey | WRELNIKBVJWXFE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.00 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(2,3,5,6-tetrachlorophenyl)furan-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,3,5,6-tetrachlorophenyl)furan-2-yl]methanamine?
The IUPAC name of [3-(2,3,5,6-tetrachlorophenyl)furan-2-yl]methanamine (CID 106888558) is [3-(2,3,5,6-tetrachlorophenyl)furan-2-yl]methanamine.
What is the SMILES notation for [3-(2,3,5,6-tetrachlorophenyl)furan-2-yl]methanamine?
The canonical SMILES for [3-(2,3,5,6-tetrachlorophenyl)furan-2-yl]methanamine is NCc1occc1-c1c(Cl)c(Cl)cc(Cl)c1Cl.
What is the InChIKey of [3-(2,3,5,6-tetrachlorophenyl)furan-2-yl]methanamine?
The InChIKey is WRELNIKBVJWXFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7Cl4NO/c12-6-3-7(13)11(15)9(10(6)14)5-1-2-17-8(5)4-16/h1-3H,4,16H2.
What are the key properties of [3-(2,3,5,6-tetrachlorophenyl)furan-2-yl]methanamine?
[3-(2,3,5,6-tetrachlorophenyl)furan-2-yl]methanamine has a molecular weight of 311.00 g/mol, XLogP of 5.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,3,5,6-tetrachlorophenyl)furan-2-yl]methanamine is sourced from PubChem (CID 106888558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).