About [3-(2-chloro-4,5-dimethylphenyl)furan-2-yl]methanamine
[3-(2-chloro-4,5-dimethylphenyl)furan-2-yl]methanamine (PubChem CID 106889012) has the molecular formula C13H14ClNO
and a molecular weight of 235.71 g/mol. Its IUPAC name is [3-(2-chloro-4,5-dimethylphenyl)furan-2-yl]methanamine.
Molecular Properties
| Compound Name | [3-(2-chloro-4,5-dimethylphenyl)furan-2-yl]methanamine |
| PubChem CID | 106889012 |
| Molecular Formula | C13H14ClNO |
| Molecular Weight | 235.71 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | [3-(2-chloro-4,5-dimethylphenyl)furan-2-yl]methanamine |
| SMILES | Cc1cc(Cl)c(-c2ccoc2CN)cc1C |
| InChI | InChI=1S/C13H14ClNO/c1-8-5-11(12(14)6-9(8)2)10-3-4-16-13(10)7-15/h3-6H,7,15H2,1-2H3 |
| InChIKey | DBYWWJMHKRAINT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.71 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-(2-chloro-4,5-dimethylphenyl)furan-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-chloro-4,5-dimethylphenyl)furan-2-yl]methanamine?
The IUPAC name of [3-(2-chloro-4,5-dimethylphenyl)furan-2-yl]methanamine (CID 106889012) is [3-(2-chloro-4,5-dimethylphenyl)furan-2-yl]methanamine.
What is the SMILES notation for [3-(2-chloro-4,5-dimethylphenyl)furan-2-yl]methanamine?
The canonical SMILES for [3-(2-chloro-4,5-dimethylphenyl)furan-2-yl]methanamine is Cc1cc(Cl)c(-c2ccoc2CN)cc1C.
What is the InChIKey of [3-(2-chloro-4,5-dimethylphenyl)furan-2-yl]methanamine?
The InChIKey is DBYWWJMHKRAINT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClNO/c1-8-5-11(12(14)6-9(8)2)10-3-4-16-13(10)7-15/h3-6H,7,15H2,1-2H3.
What are the key properties of [3-(2-chloro-4,5-dimethylphenyl)furan-2-yl]methanamine?
[3-(2-chloro-4,5-dimethylphenyl)furan-2-yl]methanamine has a molecular weight of 235.71 g/mol, XLogP of 3.68, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-chloro-4,5-dimethylphenyl)furan-2-yl]methanamine is sourced from PubChem (CID 106889012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).