C13H19Cl2N3 — CID 106890415
3,5-dichloro-4-(4-ethyl-3-methylpiperazin-1-yl)aniline (PubChem CID 106890415) has the molecular formula C13H19Cl2N3 and a molecular weight of 288.22 g/mol. Its IUPAC name is 3,5-dichloro-4-(4-ethyl-3-methylpiperazin-1-yl)aniline.
| Compound Name | 3,5-dichloro-4-(4-ethyl-3-methylpiperazin-1-yl)aniline |
|---|---|
| PubChem CID | 106890415 |
| Molecular Formula | C13H19Cl2N3 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 3,5-dichloro-4-(4-ethyl-3-methylpiperazin-1-yl)aniline |
| SMILES | CCN1CCN(c2c(Cl)cc(N)cc2Cl)CC1C |
| InChI | InChI=1S/C13H19Cl2N3/c1-3-17-4-5-18(8-9(17)2)13-11(14)6-10(16)7-12(13)15/h6-7,9H,3-5,8,16H2,1-2H3 |
| InChIKey | KAUWBPOKDVRKGD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|