C14H20Cl2N2O — CID 106890868
3,5-dichloro-4-(2,2,6,6-tetramethylmorpholin-4-yl)aniline (PubChem CID 106890868) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is 3,5-dichloro-4-(2,2,6,6-tetramethylmorpholin-4-yl)aniline.
| Compound Name | 3,5-dichloro-4-(2,2,6,6-tetramethylmorpholin-4-yl)aniline |
|---|---|
| PubChem CID | 106890868 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 3,5-dichloro-4-(2,2,6,6-tetramethylmorpholin-4-yl)aniline |
| SMILES | CC1(C)CN(c2c(Cl)cc(N)cc2Cl)CC(C)(C)O1 |
| InChI | InChI=1S/C14H20Cl2N2O/c1-13(2)7-18(8-14(3,4)19-13)12-10(15)5-9(17)6-11(12)16/h5-6H,7-8,17H2,1-4H3 |
| InChIKey | PXMYCUATBDLYGW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|