C14H11F4NO3S — CID 10689117
4-methyl-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 10689117) has the molecular formula C14H11F4NO3S and a molecular weight of 349.31 g/mol. Its IUPAC name is 4-methyl-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-methyl-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 10689117 |
| Molecular Formula | C14H11F4NO3S |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 4-methyl-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(-c2ccc(OCC(F)(F)C(F)F)cc2)sc1C(=O)O |
| InChI | InChI=1S/C14H11F4NO3S/c1-7-10(12(20)21)23-11(19-7)8-2-4-9(5-3-8)22-6-14(17,18)13(15)16/h2-5,13H,6H2,1H3,(H,20,21) |
| InChIKey | KWVACZNBGKTIIZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|