C10H7Cl2N3S — CID 106891354
3,5-dichloro-4-pyrimidin-4-ylsulfanylaniline (PubChem CID 106891354) has the molecular formula C10H7Cl2N3S and a molecular weight of 272.16 g/mol. Its IUPAC name is 3,5-dichloro-4-pyrimidin-4-ylsulfanylaniline.
| Compound Name | 3,5-dichloro-4-pyrimidin-4-ylsulfanylaniline |
|---|---|
| PubChem CID | 106891354 |
| Molecular Formula | C10H7Cl2N3S |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | 3,5-dichloro-4-pyrimidin-4-ylsulfanylaniline |
| SMILES | Nc1cc(Cl)c(Sc2ccncn2)c(Cl)c1 |
| InChI | InChI=1S/C10H7Cl2N3S/c11-7-3-6(13)4-8(12)10(7)16-9-1-2-14-5-15-9/h1-5H,13H2 |
| InChIKey | FWCCVUSHIVGEIS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|