C19H19N5S — CID 10689158
7-[4-(thiophen-2-ylmethyl)piperazin-1-yl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 10689158) has the molecular formula C19H19N5S and a molecular weight of 349.46 g/mol. Its IUPAC name is 7-[4-(thiophen-2-ylmethyl)piperazin-1-yl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 7-[4-(thiophen-2-ylmethyl)piperazin-1-yl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 10689158 |
| Molecular Formula | C19H19N5S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 7-[4-(thiophen-2-ylmethyl)piperazin-1-yl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | c1csc(CN2CCN(c3nc4cccnc4n4cccc34)CC2)c1 |
| InChI | InChI=1S/C19H19N5S/c1-5-16-18(20-7-1)24-8-2-6-17(24)19(21-16)23-11-9-22(10-12-23)14-15-4-3-13-25-15/h1-8,13H,9-12,14H2 |
| InChIKey | FBZIPLZZCYHKRT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 36.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |