C12H14Cl2N2O4 — CID 106891970
methyl 3-(2,6-dichloro-N-ethyl-4-nitroanilino)propanoate (PubChem CID 106891970) has the molecular formula C12H14Cl2N2O4 and a molecular weight of 321.16 g/mol. Its IUPAC name is methyl 3-(2,6-dichloro-N-ethyl-4-nitroanilino)propanoate.
| Compound Name | methyl 3-(2,6-dichloro-N-ethyl-4-nitroanilino)propanoate |
|---|---|
| PubChem CID | 106891970 |
| Molecular Formula | C12H14Cl2N2O4 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | methyl 3-(2,6-dichloro-N-ethyl-4-nitroanilino)propanoate |
| SMILES | CCN(CCC(=O)OC)c1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C12H14Cl2N2O4/c1-3-15(5-4-11(17)20-2)12-9(13)6-8(16(18)19)7-10(12)14/h6-7H,3-5H2,1-2H3 |
| InChIKey | WCJQRCXZMBNBEI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|