C20H30O5 — CID 10689217
[(2R,3R,3aS,4S,7S,7aR)-3-hydroxy-7,7a-dimethyl-4'-methylidene-2'-oxospiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-4-yl] 3-methylbutanoate (PubChem CID 10689217) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is [(2R,3R,3aS,4S,7S,7aR)-3-hydroxy-7,7a-dimethyl-4'-methylidene-2'-oxospiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-4-yl] 3-methylbutanoate.
| Compound Name | [(2R,3R,3aS,4S,7S,7aR)-3-hydroxy-7,7a-dimethyl-4'-methylidene-2'-oxospiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-4-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 10689217 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | [(2R,3R,3aS,4S,7S,7aR)-3-hydroxy-7,7a-dimethyl-4'-methylidene-2'-oxospiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-4-yl] 3-methylbutanoate |
| SMILES | C=C1COC(=O)[C@]12C[C@@]1(C)[C@H]([C@@H](OC(=O)CC(C)C)CC[C@@H]1C)[C@H]2O |
| InChI | InChI=1S/C20H30O5/c1-11(2)8-15(21)25-14-7-6-12(3)19(5)10-20(17(22)16(14)19)13(4)9-24-18(20)23/h11-12,14,16-17,22H,4,6-10H2,1-3,5H3/t12-,14-,16+,17+,19+,20+/m0/s1 |
| InChIKey | YRGARSMVKDFOAY-XCJOJWPZSA-N |
| XLogP | 2.86 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|