C18H24N2O — CID 106893265
[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,3-dihydro-1H-inden-2-yl)methanone (PubChem CID 106893265) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,3-dihydro-1H-inden-2-yl)methanone.
| Compound Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,3-dihydro-1H-inden-2-yl)methanone |
|---|---|
| PubChem CID | 106893265 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,3-dihydro-1H-inden-2-yl)methanone |
| SMILES | NC1CC[C@@H]2CN(C(=O)C3Cc4ccccc4C3)C[C@@H]2C1 |
| InChI | InChI=1S/C18H24N2O/c19-17-6-5-14-10-20(11-16(14)9-17)18(21)15-7-12-3-1-2-4-13(12)8-15/h1-4,14-17H,5-11,19H2/t14-,16+,17?/m1/s1 |
| InChIKey | YDJVFHXGHCOKEJ-UMFITKPXSA-N |
| XLogP | 1.99 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |