C17H22N2O — CID 106893464
2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl(2,3-dihydro-1H-inden-2-yl)methanone (PubChem CID 106893464) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl(2,3-dihydro-1H-inden-2-yl)methanone.
| Compound Name | 2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl(2,3-dihydro-1H-inden-2-yl)methanone |
|---|---|
| PubChem CID | 106893464 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl(2,3-dihydro-1H-inden-2-yl)methanone |
| SMILES | O=C(C1Cc2ccccc2C1)N1CCCC2CNCC21 |
| InChI | InChI=1S/C17H22N2O/c20-17(15-8-12-4-1-2-5-13(12)9-15)19-7-3-6-14-10-18-11-16(14)19/h1-2,4-5,14-16,18H,3,6-11H2 |
| InChIKey | CUFKSSVDIPXSPW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |