C12H9F4NO2S — CID 106893794
5-fluoro-7-methyl-1-[2-(trifluoromethylsulfanyl)ethyl]indole-2,3-dione (PubChem CID 106893794) has the molecular formula C12H9F4NO2S and a molecular weight of 307.27 g/mol. Its IUPAC name is 5-fluoro-7-methyl-1-[2-(trifluoromethylsulfanyl)ethyl]indole-2,3-dione.
| Compound Name | 5-fluoro-7-methyl-1-[2-(trifluoromethylsulfanyl)ethyl]indole-2,3-dione |
|---|---|
| PubChem CID | 106893794 |
| Molecular Formula | C12H9F4NO2S |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 5-fluoro-7-methyl-1-[2-(trifluoromethylsulfanyl)ethyl]indole-2,3-dione |
| SMILES | Cc1cc(F)cc2c1N(CCSC(F)(F)F)C(=O)C2=O |
| InChI | InChI=1S/C12H9F4NO2S/c1-6-4-7(13)5-8-9(6)17(11(19)10(8)18)2-3-20-12(14,15)16/h4-5H,2-3H2,1H3 |
| InChIKey | JKQRWLZPYPMGQH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|