C14H13FN4O2 — CID 106893899
1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-5-fluoro-7-methylindole-2,3-dione (PubChem CID 106893899) has the molecular formula C14H13FN4O2 and a molecular weight of 288.28 g/mol. Its IUPAC name is 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-5-fluoro-7-methylindole-2,3-dione.
| Compound Name | 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-5-fluoro-7-methylindole-2,3-dione |
|---|---|
| PubChem CID | 106893899 |
| Molecular Formula | C14H13FN4O2 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-5-fluoro-7-methylindole-2,3-dione |
| SMILES | CCn1ncnc1CN1C(=O)C(=O)c2cc(F)cc(C)c21 |
| InChI | InChI=1S/C14H13FN4O2/c1-3-19-11(16-7-17-19)6-18-12-8(2)4-9(15)5-10(12)13(20)14(18)21/h4-5,7H,3,6H2,1-2H3 |
| InChIKey | KCPNTJMSZPMDDT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|