C17H22ClNO — CID 106894184
[2-(2-chloroethyl)piperidin-1-yl]-(2,3-dihydro-1H-inden-2-yl)methanone (PubChem CID 106894184) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is [2-(2-chloroethyl)piperidin-1-yl]-(2,3-dihydro-1H-inden-2-yl)methanone.
| Compound Name | [2-(2-chloroethyl)piperidin-1-yl]-(2,3-dihydro-1H-inden-2-yl)methanone |
|---|---|
| PubChem CID | 106894184 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | [2-(2-chloroethyl)piperidin-1-yl]-(2,3-dihydro-1H-inden-2-yl)methanone |
| SMILES | O=C(C1Cc2ccccc2C1)N1CCCCC1CCCl |
| InChI | InChI=1S/C17H22ClNO/c18-9-8-16-7-3-4-10-19(16)17(20)15-11-13-5-1-2-6-14(13)12-15/h1-2,5-6,15-16H,3-4,7-12H2 |
| InChIKey | NTFXUWYCSAMMNU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|