C14H17Cl2NO — CID 106894284
N-(1,3-dichloro-2-methylpropan-2-yl)-2,3-dihydro-1H-indene-2-carboxamide (PubChem CID 106894284) has the molecular formula C14H17Cl2NO and a molecular weight of 286.20 g/mol. Its IUPAC name is N-(1,3-dichloro-2-methylpropan-2-yl)-2,3-dihydro-1H-indene-2-carboxamide.
| Compound Name | N-(1,3-dichloro-2-methylpropan-2-yl)-2,3-dihydro-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 106894284 |
| Molecular Formula | C14H17Cl2NO |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | N-(1,3-dichloro-2-methylpropan-2-yl)-2,3-dihydro-1H-indene-2-carboxamide |
| SMILES | CC(CCl)(CCl)NC(=O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C14H17Cl2NO/c1-14(8-15,9-16)17-13(18)12-6-10-4-2-3-5-11(10)7-12/h2-5,12H,6-9H2,1H3,(H,17,18) |
| InChIKey | NTCIQOQNIWOQIC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|