C10H10BrN5 — CID 106894815
5-bromo-2-N-(pyridazin-3-ylmethyl)pyridine-2,3-diamine (PubChem CID 106894815) has the molecular formula C10H10BrN5 and a molecular weight of 280.13 g/mol. Its IUPAC name is 5-bromo-2-N-(pyridazin-3-ylmethyl)pyridine-2,3-diamine.
| Compound Name | 5-bromo-2-N-(pyridazin-3-ylmethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 106894815 |
| Molecular Formula | C10H10BrN5 |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 5-bromo-2-N-(pyridazin-3-ylmethyl)pyridine-2,3-diamine |
| SMILES | Nc1cc(Br)cnc1NCc1cccnn1 |
| InChI | InChI=1S/C10H10BrN5/c11-7-4-9(12)10(13-5-7)14-6-8-2-1-3-15-16-8/h1-5H,6,12H2,(H,13,14) |
| InChIKey | MTGCXMGZAALQPH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |