C13H13N3O4S — CID 106894941
3-(pyridazin-3-ylmethylsulfamoylmethyl)benzoic acid (PubChem CID 106894941) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is 3-(pyridazin-3-ylmethylsulfamoylmethyl)benzoic acid.
| Compound Name | 3-(pyridazin-3-ylmethylsulfamoylmethyl)benzoic acid |
|---|---|
| PubChem CID | 106894941 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 3-(pyridazin-3-ylmethylsulfamoylmethyl)benzoic acid |
| SMILES | O=C(O)c1cccc(CS(=O)(=O)NCc2cccnn2)c1 |
| InChI | InChI=1S/C13H13N3O4S/c17-13(18)11-4-1-3-10(7-11)9-21(19,20)15-8-12-5-2-6-14-16-12/h1-7,15H,8-9H2,(H,17,18) |
| InChIKey | VYHGTNDLIXCUHL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |