C16H19N3O2 — CID 106895026
4-(1,3-benzodioxol-5-yl)-N-(pyridazin-3-ylmethyl)butan-2-amine (PubChem CID 106895026) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-N-(pyridazin-3-ylmethyl)butan-2-amine.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-N-(pyridazin-3-ylmethyl)butan-2-amine |
|---|---|
| PubChem CID | 106895026 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-N-(pyridazin-3-ylmethyl)butan-2-amine |
| SMILES | CC(CCc1ccc2c(c1)OCO2)NCc1cccnn1 |
| InChI | InChI=1S/C16H19N3O2/c1-12(17-10-14-3-2-8-18-19-14)4-5-13-6-7-15-16(9-13)21-11-20-15/h2-3,6-9,12,17H,4-5,10-11H2,1H3 |
| InChIKey | RVTHAPIUGXBVJA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |