C20H22FN3O2 — CID 10689552
(3S)-3-amino-5-(2-fluorophenyl)-1-(3-methylbutyl)-1,5-benzodiazepine-2,4-dione (PubChem CID 10689552) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is (3S)-3-amino-5-(2-fluorophenyl)-1-(3-methylbutyl)-1,5-benzodiazepine-2,4-dione.
| Compound Name | (3S)-3-amino-5-(2-fluorophenyl)-1-(3-methylbutyl)-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 10689552 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (3S)-3-amino-5-(2-fluorophenyl)-1-(3-methylbutyl)-1,5-benzodiazepine-2,4-dione |
| SMILES | CC(C)CCN1C(=O)[C@H](N)C(=O)N(c2ccccc2F)c2ccccc21 |
| InChI | InChI=1S/C20H22FN3O2/c1-13(2)11-12-23-16-9-5-6-10-17(16)24(20(26)18(22)19(23)25)15-8-4-3-7-14(15)21/h3-10,13,18H,11-12,22H2,1-2H3/t18-/m0/s1 |
| InChIKey | PRZDVFVBNDTXDW-SFHVURJKSA-N |
| XLogP | 3.21 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|