C11H11N5O — CID 106896014
3-amino-N-(pyridazin-3-ylmethyl)pyridine-2-carboxamide (PubChem CID 106896014) has the molecular formula C11H11N5O and a molecular weight of 229.24 g/mol. Its IUPAC name is 3-amino-N-(pyridazin-3-ylmethyl)pyridine-2-carboxamide.
| Compound Name | 3-amino-N-(pyridazin-3-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106896014 |
| Molecular Formula | C11H11N5O |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 3-amino-N-(pyridazin-3-ylmethyl)pyridine-2-carboxamide |
| SMILES | Nc1cccnc1C(=O)NCc1cccnn1 |
| InChI | InChI=1S/C11H11N5O/c12-9-4-2-5-13-10(9)11(17)14-7-8-3-1-6-15-16-8/h1-6H,7,12H2,(H,14,17) |
| InChIKey | MUBBFQQNPIOSNQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |