C10H15N3O2 — CID 106896706
5-(pyridazin-3-ylmethylamino)pentanoic acid (PubChem CID 106896706) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 5-(pyridazin-3-ylmethylamino)pentanoic acid.
| Compound Name | 5-(pyridazin-3-ylmethylamino)pentanoic acid |
|---|---|
| PubChem CID | 106896706 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 5-(pyridazin-3-ylmethylamino)pentanoic acid |
| SMILES | O=C(O)CCCCNCc1cccnn1 |
| InChI | InChI=1S/C10H15N3O2/c14-10(15)5-1-2-6-11-8-9-4-3-7-12-13-9/h3-4,7,11H,1-2,5-6,8H2,(H,14,15) |
| InChIKey | TUVJEUFFCHQYTH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|