C13H16N4O2 — CID 106897973
3-cyclopropyl-1-(pyridazin-3-ylmethyl)-1,4-diazepane-2,5-dione (PubChem CID 106897973) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 3-cyclopropyl-1-(pyridazin-3-ylmethyl)-1,4-diazepane-2,5-dione.
| Compound Name | 3-cyclopropyl-1-(pyridazin-3-ylmethyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 106897973 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3-cyclopropyl-1-(pyridazin-3-ylmethyl)-1,4-diazepane-2,5-dione |
| SMILES | O=C1CCN(Cc2cccnn2)C(=O)C(C2CC2)N1 |
| InChI | InChI=1S/C13H16N4O2/c18-11-5-7-17(8-10-2-1-6-14-16-10)13(19)12(15-11)9-3-4-9/h1-2,6,9,12H,3-5,7-8H2,(H,15,18) |
| InChIKey | GBTIEOLYMTZGGH-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |