About 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)-3-methyltriazole-4-sulfonamide
5-bromo-N-(3,3-difluoro-2-hydroxypropyl)-3-methyltriazole-4-sulfonamide (PubChem CID 106898551) has the molecular formula C6H9BrF2N4O3S
and a molecular weight of 335.13 g/mol. Its IUPAC name is 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)-3-methyltriazole-4-sulfonamide.
Molecular Properties
| Compound Name | 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)-3-methyltriazole-4-sulfonamide |
| PubChem CID | 106898551 |
| Molecular Formula | C6H9BrF2N4O3S |
| Molecular Weight | 335.13 g/mol |
| Exact Mass | 333.95 |
| IUPAC Name | 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)-3-methyltriazole-4-sulfonamide |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)NCC(O)C(F)F |
| InChI | InChI=1S/C6H9BrF2N4O3S/c1-13-6(4(7)11-12-13)17(15,16)10-2-3(14)5(8)9/h3,5,10,14H,2H2,1H3 |
| InChIKey | QAQRJRIRWBMFBI-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.13 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)-3-methyltriazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)-3-methyltriazole-4-sulfonamide?
The IUPAC name of 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)-3-methyltriazole-4-sulfonamide (CID 106898551) is 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)-3-methyltriazole-4-sulfonamide.
What is the SMILES notation for 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)-3-methyltriazole-4-sulfonamide?
The canonical SMILES for 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)-3-methyltriazole-4-sulfonamide is Cn1nnc(Br)c1S(=O)(=O)NCC(O)C(F)F.
What is the InChIKey of 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)-3-methyltriazole-4-sulfonamide?
The InChIKey is QAQRJRIRWBMFBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrF2N4O3S/c1-13-6(4(7)11-12-13)17(15,16)10-2-3(14)5(8)9/h3,5,10,14H,2H2,1H3.
What are the key properties of 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)-3-methyltriazole-4-sulfonamide?
5-bromo-N-(3,3-difluoro-2-hydroxypropyl)-3-methyltriazole-4-sulfonamide has a molecular weight of 335.13 g/mol, XLogP of -0.52, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)-3-methyltriazole-4-sulfonamide is sourced from PubChem (CID 106898551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).