About 5-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-3-methyltriazole-4-sulfonamide
5-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-3-methyltriazole-4-sulfonamide (PubChem CID 106898590) has the molecular formula C7H11BrF2N4O3S
and a molecular weight of 349.16 g/mol. Its IUPAC name is 5-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-3-methyltriazole-4-sulfonamide.
Molecular Properties
| Compound Name | 5-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-3-methyltriazole-4-sulfonamide |
| PubChem CID | 106898590 |
| Molecular Formula | C7H11BrF2N4O3S |
| Molecular Weight | 349.16 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 5-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-3-methyltriazole-4-sulfonamide |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)NCCOCC(F)F |
| InChI | InChI=1S/C7H11BrF2N4O3S/c1-14-7(6(8)12-13-14)18(15,16)11-2-3-17-4-5(9)10/h5,11H,2-4H2,1H3 |
| InChIKey | VUUBSEJKQTYDOK-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.16 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-3-methyltriazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-3-methyltriazole-4-sulfonamide?
The IUPAC name of 5-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-3-methyltriazole-4-sulfonamide (CID 106898590) is 5-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-3-methyltriazole-4-sulfonamide.
What is the SMILES notation for 5-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-3-methyltriazole-4-sulfonamide?
The canonical SMILES for 5-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-3-methyltriazole-4-sulfonamide is Cn1nnc(Br)c1S(=O)(=O)NCCOCC(F)F.
What is the InChIKey of 5-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-3-methyltriazole-4-sulfonamide?
The InChIKey is VUUBSEJKQTYDOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BrF2N4O3S/c1-14-7(6(8)12-13-14)18(15,16)11-2-3-17-4-5(9)10/h5,11H,2-4H2,1H3.
What are the key properties of 5-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-3-methyltriazole-4-sulfonamide?
5-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-3-methyltriazole-4-sulfonamide has a molecular weight of 349.16 g/mol, XLogP of 0.14, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-3-methyltriazole-4-sulfonamide is sourced from PubChem (CID 106898590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).