C20H24O6 — CID 10689865
(1R,2R,4S,6R,8S,9S)-8-hydroxy-6-methyl-2,9-bis(prop-1-en-2-yl)-5,14-dioxatricyclo[10.2.1.04,6]pentadec-12(15)-ene-3,7,13-trione (PubChem CID 10689865) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is (1R,2R,4S,6R,8S,9S)-8-hydroxy-6-methyl-2,9-bis(prop-1-en-2-yl)-5,14-dioxatricyclo[10.2.1.04,6]pentadec-12(15)-ene-3,7,13-trione.
| Compound Name | (1R,2R,4S,6R,8S,9S)-8-hydroxy-6-methyl-2,9-bis(prop-1-en-2-yl)-5,14-dioxatricyclo[10.2.1.04,6]pentadec-12(15)-ene-3,7,13-trione |
|---|---|
| PubChem CID | 10689865 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (1R,2R,4S,6R,8S,9S)-8-hydroxy-6-methyl-2,9-bis(prop-1-en-2-yl)-5,14-dioxatricyclo[10.2.1.04,6]pentadec-12(15)-ene-3,7,13-trione |
| SMILES | C=C(C)[C@H]1C(=O)[C@H]2O[C@@]2(C)C(=O)[C@@H](O)[C@H](C(=C)C)CCC2=C[C@H]1OC2=O |
| InChI | InChI=1S/C20H24O6/c1-9(2)12-7-6-11-8-13(25-19(11)24)14(10(3)4)16(22)18-20(5,26-18)17(23)15(12)21/h8,12-15,18,21H,1,3,6-7H2,2,4-5H3/t12-,13+,14+,15-,18+,20-/m0/s1 |
| InChIKey | WOMRTJSIYKFGTI-GQVLZEMHSA-N |
| XLogP | 1.67 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|