C18H20N2O4S — CID 10689875
dimethyl 2-methyl-6-(prop-2-enyliminomethyl)-4-thiophen-2-yl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10689875) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is dimethyl 2-methyl-6-(prop-2-enyliminomethyl)-4-thiophen-2-yl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 2-methyl-6-(prop-2-enyliminomethyl)-4-thiophen-2-yl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10689875 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | dimethyl 2-methyl-6-(prop-2-enyliminomethyl)-4-thiophen-2-yl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | C=CC/N=C/C1=C(C(=O)OC)C(c2cccs2)C(C(=O)OC)=C(C)N1 |
| InChI | InChI=1S/C18H20N2O4S/c1-5-8-19-10-12-15(18(22)24-4)16(13-7-6-9-25-13)14(11(2)20-12)17(21)23-3/h5-7,9-10,16,20H,1,8H2,2-4H3/b19-10+ |
| InChIKey | XMZUCXAACNMWRN-VXLYETTFSA-N |
| XLogP | 2.57 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|