C22H36O2Si — CID 10689908
(2E,4E,6E,8E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-2,7,11-trimethyltrideca-2,4,6,8,10-pentaenal (PubChem CID 10689908) has the molecular formula C22H36O2Si and a molecular weight of 360.61 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-2,7,11-trimethyltrideca-2,4,6,8,10-pentaenal.
| Compound Name | (2E,4E,6E,8E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-2,7,11-trimethyltrideca-2,4,6,8,10-pentaenal |
|---|---|
| PubChem CID | 10689908 |
| Molecular Formula | C22H36O2Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | (2E,4E,6E,8E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-2,7,11-trimethyltrideca-2,4,6,8,10-pentaenal |
| SMILES | C/C(C=O)=C\C=C\C=C(C)\C=C\C=C(/C)C(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H36O2Si/c1-18(13-10-11-14-19(2)17-23)15-12-16-20(3)21(4)24-25(8,9)22(5,6)7/h10-17,21H,1-9H3/b11-10+,15-12+,18-13+,19-14+,20-16+ |
| InChIKey | BTGCZZOGMCRNGB-FMFFAWKOSA-N |
| XLogP | 6.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|